C25H32N4O5S — CID 38097553
3-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-[2-(morpholine-4-carbonyl)phenyl]benzamide (PubChem CID 38097553) has the molecular formula C25H32N4O5S and a molecular weight of 500.62 g/mol. Its IUPAC name is 3-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-[2-(morpholine-4-carbonyl)phenyl]benzamide.
| Compound Name | 3-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-[2-(morpholine-4-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 38097553 |
| Molecular Formula | C25H32N4O5S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 3-[(4-ethylsulfonylpiperazin-1-yl)methyl]-N-[2-(morpholine-4-carbonyl)phenyl]benzamide |
| SMILES | CCS(=O)(=O)N1CCN(Cc2cccc(C(=O)Nc3ccccc3C(=O)N3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C25H32N4O5S/c1-2-35(32,33)29-12-10-27(11-13-29)19-20-6-5-7-21(18-20)24(30)26-23-9-4-3-8-22(23)25(31)28-14-16-34-17-15-28/h3-9,18H,2,10-17,19H2,1H3,(H,26,30) |
| InChIKey | XKUWNTWPPZXNTE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |