C17H23NO — CID 143766588
(3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one (PubChem CID 143766588) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one.
| Compound Name | (3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one |
|---|---|
| PubChem CID | 143766588 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (3E,5E,7E,9Z,11Z)-3-(C,N-dimethylcarbonimidoyl)-7-methyltrideca-3,5,7,9,11-pentaen-2-one |
| SMILES | C/C=C\C=C/C=C(C)/C=C/C=C(C(C)=O)\C(C)=N\C |
| InChI | InChI=1S/C17H23NO/c1-6-7-8-9-11-14(2)12-10-13-17(16(4)19)15(3)18-5/h6-13H,1-5H3/b7-6-,9-8-,12-10+,14-11+,17-13+,18-15+ |
| InChIKey | YPGHRVJJJBREBJ-WJKKMKAHSA-N |
| XLogP | 4.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|