C17H11NO3 — CID 14376738
5,10-dioxo-2,3-dihydronaphtho[2,3-f]indole-1-carbaldehyde (PubChem CID 14376738) has the molecular formula C17H11NO3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 5,10-dioxo-2,3-dihydronaphtho[2,3-f]indole-1-carbaldehyde.
| Compound Name | 5,10-dioxo-2,3-dihydronaphtho[2,3-f]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 14376738 |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5,10-dioxo-2,3-dihydronaphtho[2,3-f]indole-1-carbaldehyde |
| SMILES | O=CN1CCc2cc3c(cc21)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C17H11NO3/c19-9-18-6-5-10-7-13-14(8-15(10)18)17(21)12-4-2-1-3-11(12)16(13)20/h1-4,7-9H,5-6H2 |
| InChIKey | UNCKSDQFPRETLE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|