C32H47NO3 — CID 143767437
(2R,4aS,7S,8aR)-7-[(1R)-1-ethyl-6-hydroxy-1,5-dimethyl-7-oxonaphthalen-2-yl]-N,N,2,4a,7,8,8-heptamethyl-1,3,4,5,6,8a-hexahydronaphthalene-2-carboxamide (PubChem CID 143767437) has the molecular formula C32H47NO3 and a molecular weight of 493.73 g/mol. Its IUPAC name is (2R,4aS,7S,8aR)-7-[(1R)-1-ethyl-6-hydroxy-1,5-dimethyl-7-oxonaphthalen-2-yl]-N,N,2,4a,7,8,8-heptamethyl-1,3,4,5,6,8a-hexahydronaphthalene-2-carboxamide.
| Compound Name | (2R,4aS,7S,8aR)-7-[(1R)-1-ethyl-6-hydroxy-1,5-dimethyl-7-oxonaphthalen-2-yl]-N,N,2,4a,7,8,8-heptamethyl-1,3,4,5,6,8a-hexahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 143767437 |
| Molecular Formula | C32H47NO3 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.36 |
| IUPAC Name | (2R,4aS,7S,8aR)-7-[(1R)-1-ethyl-6-hydroxy-1,5-dimethyl-7-oxonaphthalen-2-yl]-N,N,2,4a,7,8,8-heptamethyl-1,3,4,5,6,8a-hexahydronaphthalene-2-carboxamide |
| SMILES | CC[C@@]1(C)C2=CC(=O)C(O)=C(C)C2=CC=C1[C@@]1(C)CC[C@@]2(C)CC[C@@](C)(C(=O)N(C)C)C[C@H]2C1(C)C |
| InChI | InChI=1S/C32H47NO3/c1-11-31(7)22-18-23(34)26(35)20(2)21(22)12-13-24(31)32(8)17-16-29(5)14-15-30(6,27(36)33(9)10)19-25(29)28(32,3)4/h12-13,18,25,35H,11,14-17,19H2,1-10H3/t25-,29+,30+,31-,32+/m0/s1 |
| InChIKey | WYNSKHWMTOJOIB-BEJMMGEESA-N |
| XLogP | 7.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |