C20H18FN5O — CID 143767822
2-(4-fluorophenyl)-7-methyl-1-[(4-methylphenyl)methylamino]purin-6-one (PubChem CID 143767822) has the molecular formula C20H18FN5O and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-7-methyl-1-[(4-methylphenyl)methylamino]purin-6-one.
| Compound Name | 2-(4-fluorophenyl)-7-methyl-1-[(4-methylphenyl)methylamino]purin-6-one |
|---|---|
| PubChem CID | 143767822 |
| Molecular Formula | C20H18FN5O |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-(4-fluorophenyl)-7-methyl-1-[(4-methylphenyl)methylamino]purin-6-one |
| SMILES | Cc1ccc(CNn2c(-c3ccc(F)cc3)nc3ncn(C)c3c2=O)cc1 |
| InChI | InChI=1S/C20H18FN5O/c1-13-3-5-14(6-4-13)11-23-26-19(15-7-9-16(21)10-8-15)24-18-17(20(26)27)25(2)12-22-18/h3-10,12,23H,11H2,1-2H3 |
| InChIKey | FTKLAZQDJQZPEC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |