C10H16N4O — CID 142357897
1,7-dimethylpurin-6-one;propane (PubChem CID 142357897) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 1,7-dimethylpurin-6-one;propane.
| Compound Name | 1,7-dimethylpurin-6-one;propane |
|---|---|
| PubChem CID | 142357897 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1,7-dimethylpurin-6-one;propane |
| SMILES | CCC.Cn1cnc2ncn(C)c2c1=O |
| InChI | InChI=1S/C7H8N4O.C3H8/c1-10-3-8-6-5(10)7(12)11(2)4-9-6;1-3-2/h3-4H,1-2H3;3H2,1-2H3 |
| InChIKey | QHAZBDOFHSEYHZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |