C8H11N4O+ — CID 10406096
1,7,9-trimethylpurin-9-ium-6-one (PubChem CID 10406096) has the molecular formula C8H11N4O+ and a molecular weight of 179.20 g/mol. Its IUPAC name is 1,7,9-trimethylpurin-9-ium-6-one.
| Compound Name | 1,7,9-trimethylpurin-9-ium-6-one |
|---|---|
| PubChem CID | 10406096 |
| Molecular Formula | C8H11N4O+ |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1,7,9-trimethylpurin-9-ium-6-one |
| SMILES | Cn1cnc2c(c1=O)n(C)c[n+]2C |
| InChI | InChI=1S/C8H11N4O/c1-10-4-9-7-6(8(10)13)11(2)5-12(7)3/h4-5H,1-3H3/q+1 |
| InChIKey | NNODQXZFTXWGTR-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|