C8H7IN6O2 — CID 163961021
1-(1λ3-ioda-3-oxa-2,5-diazacyclopenta-1,4-dien-4-ylmethyl)-7-methylpurin-6-one (PubChem CID 163961021) has the molecular formula C8H7IN6O2 and a molecular weight of 346.09 g/mol. Its IUPAC name is 1-(1λ3-ioda-3-oxa-2,5-diazacyclopenta-1,4-dien-4-ylmethyl)-7-methylpurin-6-one.
| Compound Name | 1-(1λ3-ioda-3-oxa-2,5-diazacyclopenta-1,4-dien-4-ylmethyl)-7-methylpurin-6-one |
|---|---|
| PubChem CID | 163961021 |
| Molecular Formula | C8H7IN6O2 |
| Molecular Weight | 346.09 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 1-(1λ3-ioda-3-oxa-2,5-diazacyclopenta-1,4-dien-4-ylmethyl)-7-methylpurin-6-one |
| SMILES | Cn1cnc2ncn(CC3=NI=NO3)c(=O)c21 |
| InChI | InChI=1S/C8H7IN6O2/c1-14-3-10-7-6(14)8(16)15(4-11-7)2-5-12-9-13-17-5/h3-4H,2H2,1H3 |
| InChIKey | SHLFEBXRHSBPSL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.09 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|