C23H17F4N3O — CID 24991648
2-(4-fluorophenyl)-7-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]quinazolin-4-one (PubChem CID 24991648) has the molecular formula C23H17F4N3O and a molecular weight of 427.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-7-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]quinazolin-4-one.
| Compound Name | 2-(4-fluorophenyl)-7-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]quinazolin-4-one |
|---|---|
| PubChem CID | 24991648 |
| Molecular Formula | C23H17F4N3O |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-(4-fluorophenyl)-7-methyl-3-[[4-(trifluoromethyl)phenyl]methylamino]quinazolin-4-one |
| SMILES | Cc1ccc2c(=O)n(NCc3ccc(C(F)(F)F)cc3)c(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C23H17F4N3O/c1-14-2-11-19-20(12-14)29-21(16-5-9-18(24)10-6-16)30(22(19)31)28-13-15-3-7-17(8-4-15)23(25,26)27/h2-12,28H,13H2,1H3 |
| InChIKey | HQWBVLMMLLJRQS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |