C25H21F3N4O3 — CID 87413166
2-[4-(dimethylamino)phenyl]-N-hydroxy-4-oxo-3-[[4-(trifluoromethyl)phenyl]methyl]quinazoline-7-carboxamide (PubChem CID 87413166) has the molecular formula C25H21F3N4O3 and a molecular weight of 482.46 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-hydroxy-4-oxo-3-[[4-(trifluoromethyl)phenyl]methyl]quinazoline-7-carboxamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-hydroxy-4-oxo-3-[[4-(trifluoromethyl)phenyl]methyl]quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 87413166 |
| Molecular Formula | C25H21F3N4O3 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-hydroxy-4-oxo-3-[[4-(trifluoromethyl)phenyl]methyl]quinazoline-7-carboxamide |
| SMILES | CN(C)c1ccc(-c2nc3cc(C(=O)NO)ccc3c(=O)n2Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H21F3N4O3/c1-31(2)19-10-5-16(6-11-19)22-29-21-13-17(23(33)30-35)7-12-20(21)24(34)32(22)14-15-3-8-18(9-4-15)25(26,27)28/h3-13,35H,14H2,1-2H3,(H,30,33) |
| InChIKey | TWKJJEVRWOWUGI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|