C9H14N2O3 — CID 143768623
N'-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]propanediamide (PubChem CID 143768623) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is N'-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]propanediamide.
| Compound Name | N'-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]propanediamide |
|---|---|
| PubChem CID | 143768623 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N'-[(2E,4E)-4-hydroxyhexa-2,4-dien-3-yl]propanediamide |
| SMILES | C/C=C(O)\C(=C/C)NC(=O)CC(N)=O |
| InChI | InChI=1S/C9H14N2O3/c1-3-6(7(12)4-2)11-9(14)5-8(10)13/h3-4,12H,5H2,1-2H3,(H2,10,13)(H,11,14)/b6-3+,7-4+ |
| InChIKey | UMYNXHGMJNFZQQ-XOKGJFMYSA-N |
| XLogP | 0.34 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|