C13H19NO2 — CID 173486149
(2E)-2-ethylidene-N-[(2E)-4-hydroxyhexa-2,4-dien-3-yl]pent-3-enamide (PubChem CID 173486149) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2E)-2-ethylidene-N-[(2E)-4-hydroxyhexa-2,4-dien-3-yl]pent-3-enamide.
| Compound Name | (2E)-2-ethylidene-N-[(2E)-4-hydroxyhexa-2,4-dien-3-yl]pent-3-enamide |
|---|---|
| PubChem CID | 173486149 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2E)-2-ethylidene-N-[(2E)-4-hydroxyhexa-2,4-dien-3-yl]pent-3-enamide |
| SMILES | CC=C/C(=C\C)C(=O)N/C(=C/C)C(O)=CC |
| InChI | InChI=1S/C13H19NO2/c1-5-9-10(6-2)13(16)14-11(7-3)12(15)8-4/h5-9,15H,1-4H3,(H,14,16)/b9-5?,10-6+,11-7+,12-8? |
| InChIKey | MHPRZPIKFQVLQM-DAUCZPMESA-N |
| XLogP | 2.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|