C32H47N7O8 — CID 143769254
3-(4-aminophenyl)-2-[[2-[[5-[(5,6-diamino-6-oxohexyl)amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]propanoic acid;ethane (PubChem CID 143769254) has the molecular formula C32H47N7O8 and a molecular weight of 657.77 g/mol. Its IUPAC name is 3-(4-aminophenyl)-2-[[2-[[5-[(5,6-diamino-6-oxohexyl)amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]propanoic acid;ethane.
| Compound Name | 3-(4-aminophenyl)-2-[[2-[[5-[(5,6-diamino-6-oxohexyl)amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]propanoic acid;ethane |
|---|---|
| PubChem CID | 143769254 |
| Molecular Formula | C32H47N7O8 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | 3-(4-aminophenyl)-2-[[2-[[5-[(5,6-diamino-6-oxohexyl)amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]propanoic acid;ethane |
| SMILES | CC.NC(=O)C(N)CCCCNC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)NCC(=O)NC(Cc1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C30H41N7O8.C2H6/c31-21-11-9-19(10-12-21)16-24(29(42)43)36-26(39)17-35-28(41)23(37-30(44)45-18-20-6-2-1-3-7-20)13-14-25(38)34-15-5-4-8-22(32)27(33)40;1-2/h1-3,6-7,9-12,22-24H,4-5,8,13-18,31-32H2,(H2,33,40)(H,34,38)(H,35,41)(H,36,39)(H,37,44)(H,42,43);1-2H3 |
| InChIKey | PSNWXTUYHNPTFX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 258.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|