C15H33N — CID 143770617
1,8-dimethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;ethane (PubChem CID 143770617) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is 1,8-dimethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;ethane.
| Compound Name | 1,8-dimethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;ethane |
|---|---|
| PubChem CID | 143770617 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 1,8-dimethyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine;ethane |
| SMILES | CC.CC.CC1CCN2CCCC(C)C2C1 |
| InChI | InChI=1S/C11H21N.2C2H6/c1-9-5-7-12-6-3-4-10(2)11(12)8-9;2*1-2/h9-11H,3-8H2,1-2H3;2*1-2H3 |
| InChIKey | GWFNRFUCQGJDJQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |