C29H26N2O4 — CID 143770737
5-(13-cyclohexyl-10-formyl-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl)-1,3-oxazole-4-carbaldehyde (PubChem CID 143770737) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-(13-cyclohexyl-10-formyl-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 5-(13-cyclohexyl-10-formyl-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 143770737 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 5-(13-cyclohexyl-10-formyl-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl)-1,3-oxazole-4-carbaldehyde |
| SMILES | COc1ccc2c(c1)C=C(c1ocnc1C=O)Cn1c-2c(C2CCCCC2)c2ccc(C=O)cc21 |
| InChI | InChI=1S/C29H26N2O4/c1-34-22-8-10-23-20(13-22)12-21(29-25(16-33)30-17-35-29)14-31-26-11-18(15-32)7-9-24(26)27(28(23)31)19-5-3-2-4-6-19/h7-13,15-17,19H,2-6,14H2,1H3 |
| InChIKey | FKFUBMMWGHXQIF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|