C15H25F2P — CID 143771443
(2-cyclohexyl-3,3-difluoro-1,2,3a,4,5,6,7,7a-octahydroinden-4-yl)phosphane (PubChem CID 143771443) has the molecular formula C15H25F2P and a molecular weight of 274.33 g/mol. Its IUPAC name is (2-cyclohexyl-3,3-difluoro-1,2,3a,4,5,6,7,7a-octahydroinden-4-yl)phosphane.
| Compound Name | (2-cyclohexyl-3,3-difluoro-1,2,3a,4,5,6,7,7a-octahydroinden-4-yl)phosphane |
|---|---|
| PubChem CID | 143771443 |
| Molecular Formula | C15H25F2P |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2-cyclohexyl-3,3-difluoro-1,2,3a,4,5,6,7,7a-octahydroinden-4-yl)phosphane |
| SMILES | FC1(F)C(C2CCCCC2)CC2CCCC(P)C21 |
| InChI | InChI=1S/C15H25F2P/c16-15(17)12(10-5-2-1-3-6-10)9-11-7-4-8-13(18)14(11)15/h10-14H,1-9,18H2 |
| InChIKey | OGWZWZJBALFIPH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|