C26H30F4O — CID 143772744
(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-14-(2-methylbut-3-enoxy)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene (PubChem CID 143772744) has the molecular formula C26H30F4O and a molecular weight of 434.52 g/mol. Its IUPAC name is (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-14-(2-methylbut-3-enoxy)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-14-(2-methylbut-3-enoxy)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772744 |
| Molecular Formula | C26H30F4O |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-2-methyl-14-(2-methylbut-3-enoxy)-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
| SMILES | C=CC(C)COC(C)C(=C)/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C |
| InChI | InChI=1S/C26H30F4O/c1-11-16(4)14-31-22(10)21(9)26(30)25(29)20(8)18(6)13-12-17(5)19(7)24(28)23(27)15(2)3/h11-13,16,22H,1-2,5-9,14H2,3-4,10H3/b13-12-,24-23-,26-25- |
| InChIKey | WXMQRMCJUZPOMB-RXBIRKEXSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|