C8H13FO — CID 143775702
(3E)-2-fluoro-3-propoxypenta-1,3-diene (PubChem CID 143775702) has the molecular formula C8H13FO and a molecular weight of 144.19 g/mol. Its IUPAC name is (3E)-2-fluoro-3-propoxypenta-1,3-diene.
| Compound Name | (3E)-2-fluoro-3-propoxypenta-1,3-diene |
|---|---|
| PubChem CID | 143775702 |
| Molecular Formula | C8H13FO |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (3E)-2-fluoro-3-propoxypenta-1,3-diene |
| SMILES | C=C(F)/C(=C\C)OCCC |
| InChI | InChI=1S/C8H13FO/c1-4-6-10-8(5-2)7(3)9/h5H,3-4,6H2,1-2H3/b8-5+ |
| InChIKey | YSBJPOJZFDGZNL-VMPITWQZSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|