C10H17FO2 — CID 123318263
3,4-diethoxy-2-fluorohexa-2,4-diene (PubChem CID 123318263) has the molecular formula C10H17FO2 and a molecular weight of 188.24 g/mol. Its IUPAC name is 3,4-diethoxy-2-fluorohexa-2,4-diene.
| Compound Name | 3,4-diethoxy-2-fluorohexa-2,4-diene |
|---|---|
| PubChem CID | 123318263 |
| Molecular Formula | C10H17FO2 |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3,4-diethoxy-2-fluorohexa-2,4-diene |
| SMILES | CC=C(OCC)C(OCC)=C(C)F |
| InChI | InChI=1S/C10H17FO2/c1-5-9(12-6-2)10(8(4)11)13-7-3/h5H,6-7H2,1-4H3 |
| InChIKey | MZVYEVNGAGBOLZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|