C9H13FO2 — CID 143331079
(3Z)-2-fluoro-5-(2-methoxyethoxy)hexa-1,3,5-triene (PubChem CID 143331079) has the molecular formula C9H13FO2 and a molecular weight of 172.20 g/mol. Its IUPAC name is (3Z)-2-fluoro-5-(2-methoxyethoxy)hexa-1,3,5-triene.
| Compound Name | (3Z)-2-fluoro-5-(2-methoxyethoxy)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143331079 |
| Molecular Formula | C9H13FO2 |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (3Z)-2-fluoro-5-(2-methoxyethoxy)hexa-1,3,5-triene |
| SMILES | C=C(F)/C=C\C(=C)OCCOC |
| InChI | InChI=1S/C9H13FO2/c1-8(10)4-5-9(2)12-7-6-11-3/h4-5H,1-2,6-7H2,3H3/b5-4- |
| InChIKey | VFTWRMFGDMGBMJ-PLNGDYQASA-N |
| XLogP | 2.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|