C8H13FO2 — CID 123737328
2-(2-fluoroethoxy)-3-methoxypenta-1,3-diene (PubChem CID 123737328) has the molecular formula C8H13FO2 and a molecular weight of 160.19 g/mol. Its IUPAC name is 2-(2-fluoroethoxy)-3-methoxypenta-1,3-diene.
| Compound Name | 2-(2-fluoroethoxy)-3-methoxypenta-1,3-diene |
|---|---|
| PubChem CID | 123737328 |
| Molecular Formula | C8H13FO2 |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-(2-fluoroethoxy)-3-methoxypenta-1,3-diene |
| SMILES | C=C(OCCF)C(=CC)OC |
| InChI | InChI=1S/C8H13FO2/c1-4-8(10-3)7(2)11-6-5-9/h4H,2,5-6H2,1,3H3 |
| InChIKey | JMBPZRLCKRSEAC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|