C11H16F2O2 — CID 143286431
(3Z)-2-ethoxy-3,4-difluoro-5-propoxyhexa-1,3,5-triene (PubChem CID 143286431) has the molecular formula C11H16F2O2 and a molecular weight of 218.24 g/mol. Its IUPAC name is (3Z)-2-ethoxy-3,4-difluoro-5-propoxyhexa-1,3,5-triene.
| Compound Name | (3Z)-2-ethoxy-3,4-difluoro-5-propoxyhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143286431 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (3Z)-2-ethoxy-3,4-difluoro-5-propoxyhexa-1,3,5-triene |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)OCCC |
| InChI | InChI=1S/C11H16F2O2/c1-5-7-15-9(4)11(13)10(12)8(3)14-6-2/h3-7H2,1-2H3/b11-10- |
| InChIKey | UVJZXKABUUXGEO-KHPPLWFESA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|