C24H32N6O3 — CID 143776180
3,4-diamino-N-[2-[4-[formyl-[2-[2-(methylamino)phenyl]ethyl]amino]piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 143776180) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is 3,4-diamino-N-[2-[4-[formyl-[2-[2-(methylamino)phenyl]ethyl]amino]piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 3,4-diamino-N-[2-[4-[formyl-[2-[2-(methylamino)phenyl]ethyl]amino]piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 143776180 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 3,4-diamino-N-[2-[4-[formyl-[2-[2-(methylamino)phenyl]ethyl]amino]piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CNc1ccccc1CCN(C=O)C1CCN(C(=O)CNC(=O)c2ccc(N)c(N)c2)CC1 |
| InChI | InChI=1S/C24H32N6O3/c1-27-22-5-3-2-4-17(22)8-11-30(16-31)19-9-12-29(13-10-19)23(32)15-28-24(33)18-6-7-20(25)21(26)14-18/h2-7,14,16,19,27H,8-13,15,25-26H2,1H3,(H,28,33) |
| InChIKey | VEZQTTIPNLLVOC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|