C14H22N2 — CID 143776829
(3Z,6E,8Z)-10-methylimino-6-prop-2-enylidenedeca-3,8-dien-1-amine (PubChem CID 143776829) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (3Z,6E,8Z)-10-methylimino-6-prop-2-enylidenedeca-3,8-dien-1-amine.
| Compound Name | (3Z,6E,8Z)-10-methylimino-6-prop-2-enylidenedeca-3,8-dien-1-amine |
|---|---|
| PubChem CID | 143776829 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3Z,6E,8Z)-10-methylimino-6-prop-2-enylidenedeca-3,8-dien-1-amine |
| SMILES | C=C/C=C(/C/C=C\C=N\C)C/C=C\CCN |
| InChI | InChI=1S/C14H22N2/c1-3-9-14(10-5-4-7-12-15)11-6-8-13-16-2/h3-6,8-9,13H,1,7,10-12,15H2,2H3/b5-4-,8-6-,14-9+,16-13+ |
| InChIKey | RWLIBVCTTZWIRM-ALZQANTCSA-N |
| XLogP | 3.04 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|