C13H21NO2S — CID 143777849
N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfonamide (PubChem CID 143777849) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 143777849 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)C2=CCCC=C2)C1 |
| InChI | InChI=1S/C13H21NO2S/c1-11-6-5-7-12(10-11)14-17(15,16)13-8-3-2-4-9-13/h3,8-9,11-12,14H,2,4-7,10H2,1H3 |
| InChIKey | JDESQQSDXLXSQH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |