C16H23NO2S — CID 143778980
5-ethylsulfanyl-3-heptan-4-yl-1,3-benzoxazol-2-one (PubChem CID 143778980) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 5-ethylsulfanyl-3-heptan-4-yl-1,3-benzoxazol-2-one.
| Compound Name | 5-ethylsulfanyl-3-heptan-4-yl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 143778980 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-ethylsulfanyl-3-heptan-4-yl-1,3-benzoxazol-2-one |
| SMILES | CCCC(CCC)n1c(=O)oc2ccc(SCC)cc21 |
| InChI | InChI=1S/C16H23NO2S/c1-4-7-12(8-5-2)17-14-11-13(20-6-3)9-10-15(14)19-16(17)18/h9-12H,4-8H2,1-3H3 |
| InChIKey | KSDVGAOKVXYLHI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |