C22H30N2O2S — CID 143779235
ethoxy-[2-[2-methyl-3-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]indol-1-yl]ethylsulfanyl]methanol (PubChem CID 143779235) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is ethoxy-[2-[2-methyl-3-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]indol-1-yl]ethylsulfanyl]methanol.
| Compound Name | ethoxy-[2-[2-methyl-3-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]indol-1-yl]ethylsulfanyl]methanol |
|---|---|
| PubChem CID | 143779235 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | ethoxy-[2-[2-methyl-3-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]indol-1-yl]ethylsulfanyl]methanol |
| SMILES | C/C=C(\C=C/NC)/C=C/c1c(C)n(CCSC(O)OCC)c2ccccc12 |
| InChI | InChI=1S/C22H30N2O2S/c1-5-18(13-14-23-4)11-12-19-17(3)24(15-16-27-22(25)26-6-2)21-10-8-7-9-20(19)21/h5,7-14,22-23,25H,6,15-16H2,1-4H3/b12-11+,14-13-,18-5- |
| InChIKey | ZDMBSXFLWKRTLH-IVYPODKGSA-N |
| XLogP | 4.69 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|