C9H16N2 — CID 143779684
1-cyclohexa-1,5-dien-1-yl-2-ethyl-1-methylhydrazine (PubChem CID 143779684) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-ethyl-1-methylhydrazine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-ethyl-1-methylhydrazine |
|---|---|
| PubChem CID | 143779684 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-ethyl-1-methylhydrazine |
| SMILES | CCNN(C)C1=CCCC=C1 |
| InChI | InChI=1S/C9H16N2/c1-3-10-11(2)9-7-5-4-6-8-9/h5,7-8,10H,3-4,6H2,1-2H3 |
| InChIKey | VALXENCTEUSDFT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|