C17H25N5S — CID 143780058
4-[(3S,4S)-3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine (PubChem CID 143780058) has the molecular formula C17H25N5S and a molecular weight of 331.49 g/mol. Its IUPAC name is 4-[(3S,4S)-3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-[(3S,4S)-3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143780058 |
| Molecular Formula | C17H25N5S |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-[(3S,4S)-3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine |
| SMILES | CNC[C@H]1CN(c2nc(N)nc3c4c(sc23)CCCC4)C[C@H]1C |
| InChI | InChI=1S/C17H25N5S/c1-10-8-22(9-11(10)7-19-2)16-15-14(20-17(18)21-16)12-5-3-4-6-13(12)23-15/h10-11,19H,3-9H2,1-2H3,(H2,18,20,21)/t10-,11+/m1/s1 |
| InChIKey | SWQRKANYTRBVLD-MNOVXSKESA-N |
| XLogP | 2.44 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |