C16H20F3N5O2S — CID 67774029
4-[(3R)-3-aminopyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 67774029) has the molecular formula C16H20F3N5O2S and a molecular weight of 403.43 g/mol. Its IUPAC name is 4-[(3R)-3-aminopyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(3R)-3-aminopyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67774029 |
| Molecular Formula | C16H20F3N5O2S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 4-[(3R)-3-aminopyrrolidin-1-yl]-6,7,8,9-tetrahydro-[1]benzothiolo[3,2-d]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1nc(N2CC[C@@H](N)C2)c2sc3c(c2n1)CCCC3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N5S.C2HF3O2/c15-8-5-6-19(7-8)13-12-11(17-14(16)18-13)9-3-1-2-4-10(9)20-12;3-2(4,5)1(6)7/h8H,1-7,15H2,(H2,16,17,18);(H,6,7)/t8-;/m1./s1 |
| InChIKey | HUHGCJDMJZPPFA-DDWIOCJRSA-N |
| XLogP | 2.32 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |