C17H21F2N5S — CID 66562894
4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-8,8-difluoro-7,9-dihydro-6H-[1]benzothiolo[3,2-d]pyrimidin-2-amine (PubChem CID 66562894) has the molecular formula C17H21F2N5S and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-8,8-difluoro-7,9-dihydro-6H-[1]benzothiolo[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-8,8-difluoro-7,9-dihydro-6H-[1]benzothiolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66562894 |
| Molecular Formula | C17H21F2N5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-8,8-difluoro-7,9-dihydro-6H-[1]benzothiolo[3,2-d]pyrimidin-2-amine |
| SMILES | CN1C[C@@H]2CN(c3nc(N)nc4c5c(sc34)CCC(F)(F)C5)C[C@@H]2C1 |
| InChI | InChI=1S/C17H21F2N5S/c1-23-5-9-7-24(8-10(9)6-23)15-14-13(21-16(20)22-15)11-4-17(18,19)3-2-12(11)25-14/h9-10H,2-8H2,1H3,(H2,20,21,22)/t9-,10+ |
| InChIKey | ZEONGBPLRISLNY-AOOOYVTPSA-N |
| XLogP | 2.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |