C21H31N5O — CID 67950680
8-tert-butyl-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-6,7,8,9-tetrahydro-[1]benzofuro[3,2-d]pyrimidin-2-amine (PubChem CID 67950680) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 8-tert-butyl-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-6,7,8,9-tetrahydro-[1]benzofuro[3,2-d]pyrimidin-2-amine.
| Compound Name | 8-tert-butyl-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-6,7,8,9-tetrahydro-[1]benzofuro[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 67950680 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 8-tert-butyl-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-6,7,8,9-tetrahydro-[1]benzofuro[3,2-d]pyrimidin-2-amine |
| SMILES | CN1CC2CN(c3nc(N)nc4c5c(oc34)CCC(C(C)(C)C)C5)CC2C1 |
| InChI | InChI=1S/C21H31N5O/c1-21(2,3)14-5-6-16-15(7-14)17-18(27-16)19(24-20(22)23-17)26-10-12-8-25(4)9-13(12)11-26/h12-14H,5-11H2,1-4H3,(H2,22,23,24) |
| InChIKey | CQMVUQDQBNHRCS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |