C16H28N6 — CID 126662892
6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2,2-dimethylpropyl)pyrimidine-2,4-diamine (PubChem CID 126662892) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2,2-dimethylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2,2-dimethylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 126662892 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-(2,2-dimethylpropyl)pyrimidine-2,4-diamine |
| SMILES | CN1C[C@@H]2CN(c3nc(N)nc(N)c3CC(C)(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C16H28N6/c1-16(2,3)5-12-13(17)19-15(18)20-14(12)22-8-10-6-21(4)7-11(10)9-22/h10-11H,5-9H2,1-4H3,(H4,17,18,19,20)/t10-,11+ |
| InChIKey | WVODAFKJSRSKDZ-PHIMTYICSA-N |
| XLogP | 1.23 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |