C35H48N4O7S — CID 143782454
benzylbenzene;ethyl (2S,6S)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-[[2-(methoxycarbonylamino)acetyl]amino]heptanoate (PubChem CID 143782454) has the molecular formula C35H48N4O7S and a molecular weight of 668.86 g/mol. Its IUPAC name is benzylbenzene;ethyl (2S,6S)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-[[2-(methoxycarbonylamino)acetyl]amino]heptanoate.
| Compound Name | benzylbenzene;ethyl (2S,6S)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-[[2-(methoxycarbonylamino)acetyl]amino]heptanoate |
|---|---|
| PubChem CID | 143782454 |
| Molecular Formula | C35H48N4O7S |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | benzylbenzene;ethyl (2S,6S)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-[[2-(methoxycarbonylamino)acetyl]amino]heptanoate |
| SMILES | CCOC(=O)[C@H](CCC[C@H](C)NC(=O)CNC(=O)OC)N(C(C)C)S(=O)(=O)c1ccc(N)cc1.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H36N4O7S.C13H12/c1-6-33-21(28)19(9-7-8-16(4)25-20(27)14-24-22(29)32-5)26(15(2)3)34(30,31)18-12-10-17(23)11-13-18;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h10-13,15-16,19H,6-9,14,23H2,1-5H3,(H,24,29)(H,25,27);1-10H,11H2/t16-,19-;/m0./s1 |
| InChIKey | LNICLIKPMLIWAB-QSVLQNJRSA-N |
| XLogP | 4.91 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|