C18H26N2O5S — CID 70271505
ethyl (E)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-oxohept-4-enoate (PubChem CID 70271505) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is ethyl (E)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-oxohept-4-enoate.
| Compound Name | ethyl (E)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-oxohept-4-enoate |
|---|---|
| PubChem CID | 70271505 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl (E)-2-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-6-oxohept-4-enoate |
| SMILES | CCOC(=O)C(C/C=C/C(C)=O)N(C(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H26N2O5S/c1-5-25-18(22)17(8-6-7-14(4)21)20(13(2)3)26(23,24)16-11-9-15(19)10-12-16/h6-7,9-13,17H,5,8,19H2,1-4H3/b7-6+ |
| InChIKey | HLQQSSYZABNKSY-VOTSOKGWSA-N |
| XLogP | 2.13 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|