C24H38N4O6S2 — CID 163672209
4-amino-N,N-di(propan-2-yl)benzenesulfonamide;4-nitro-N,N-di(propan-2-yl)benzenesulfonamide (PubChem CID 163672209) has the molecular formula C24H38N4O6S2 and a molecular weight of 542.72 g/mol. Its IUPAC name is 4-amino-N,N-di(propan-2-yl)benzenesulfonamide;4-nitro-N,N-di(propan-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N,N-di(propan-2-yl)benzenesulfonamide;4-nitro-N,N-di(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 163672209 |
| Molecular Formula | C24H38N4O6S2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 4-amino-N,N-di(propan-2-yl)benzenesulfonamide;4-nitro-N,N-di(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)c1ccc(N)cc1.CC(C)N(C(C)C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N2O4S.C12H20N2O2S/c1-9(2)13(10(3)4)19(17,18)12-7-5-11(6-8-12)14(15)16;1-9(2)14(10(3)4)17(15,16)12-7-5-11(13)6-8-12/h5-10H,1-4H3;5-10H,13H2,1-4H3 |
| InChIKey | JDNRENBNDQNPEW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|