C26H24F2N2O3 — CID 143784208
2,5-difluoro-4-[(E)-N-[1-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]ethenoxy]-C-methylcarbonimidoyl]benzamide (PubChem CID 143784208) has the molecular formula C26H24F2N2O3 and a molecular weight of 450.49 g/mol. Its IUPAC name is 2,5-difluoro-4-[(E)-N-[1-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]ethenoxy]-C-methylcarbonimidoyl]benzamide.
| Compound Name | 2,5-difluoro-4-[(E)-N-[1-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]ethenoxy]-C-methylcarbonimidoyl]benzamide |
|---|---|
| PubChem CID | 143784208 |
| Molecular Formula | C26H24F2N2O3 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2,5-difluoro-4-[(E)-N-[1-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]ethenoxy]-C-methylcarbonimidoyl]benzamide |
| SMILES | C=C(O/N=C(\C)c1cc(F)c(C(N)=O)cc1F)c1ccc(-c2ccccc2C)c(COC)c1 |
| InChI | InChI=1S/C26H24F2N2O3/c1-15-7-5-6-8-20(15)21-10-9-18(11-19(21)14-32-4)17(3)33-30-16(2)22-12-25(28)23(26(29)31)13-24(22)27/h5-13H,3,14H2,1-2,4H3,(H2,29,31)/b30-16+ |
| InChIKey | ICCPRSWSXGZBRE-OKCVXOCRSA-N |
| XLogP | 5.60 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|