C20H17F2N3O2 — CID 58553457
N-(diaminomethylidene)-8-[2,6-difluoro-4-(methoxymethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 58553457) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is N-(diaminomethylidene)-8-[2,6-difluoro-4-(methoxymethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-8-[2,6-difluoro-4-(methoxymethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58553457 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-(diaminomethylidene)-8-[2,6-difluoro-4-(methoxymethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | COCc1cc(F)c(-c2cccc3ccc(C(=O)N=C(N)N)cc23)c(F)c1 |
| InChI | InChI=1S/C20H17F2N3O2/c1-27-10-11-7-16(21)18(17(22)8-11)14-4-2-3-12-5-6-13(9-15(12)14)19(26)25-20(23)24/h2-9H,10H2,1H3,(H4,23,24,25,26) |
| InChIKey | LWWNOLQJHOGMID-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|