C16H14F3N5O — CID 143787924
3-[3-amino-4-(1-amino-2,2,2-trifluoroethyl)phenyl]imidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 143787924) has the molecular formula C16H14F3N5O and a molecular weight of 349.32 g/mol. Its IUPAC name is 3-[3-amino-4-(1-amino-2,2,2-trifluoroethyl)phenyl]imidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | 3-[3-amino-4-(1-amino-2,2,2-trifluoroethyl)phenyl]imidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 143787924 |
| Molecular Formula | C16H14F3N5O |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 3-[3-amino-4-(1-amino-2,2,2-trifluoroethyl)phenyl]imidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | NC(=O)c1ccn2c(-c3ccc(C(N)C(F)(F)F)c(N)c3)cnc2c1 |
| InChI | InChI=1S/C16H14F3N5O/c17-16(18,19)14(21)10-2-1-8(5-11(10)20)12-7-23-13-6-9(15(22)25)3-4-24(12)13/h1-7,14H,20-21H2,(H2,22,25) |
| InChIKey | KQBPVQNYMLZUHY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|