C17H14IN3O — CID 143706846
4-amino-4-[3-(3-iodophenyl)imidazo[1,2-a]pyridin-7-yl]but-3-en-2-one (PubChem CID 143706846) has the molecular formula C17H14IN3O and a molecular weight of 403.22 g/mol. Its IUPAC name is 4-amino-4-[3-(3-iodophenyl)imidazo[1,2-a]pyridin-7-yl]but-3-en-2-one.
| Compound Name | 4-amino-4-[3-(3-iodophenyl)imidazo[1,2-a]pyridin-7-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 143706846 |
| Molecular Formula | C17H14IN3O |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 4-amino-4-[3-(3-iodophenyl)imidazo[1,2-a]pyridin-7-yl]but-3-en-2-one |
| SMILES | CC(=O)C=C(N)c1ccn2c(-c3cccc(I)c3)cnc2c1 |
| InChI | InChI=1S/C17H14IN3O/c1-11(22)7-15(19)12-5-6-21-16(10-20-17(21)9-12)13-3-2-4-14(18)8-13/h2-10H,19H2,1H3 |
| InChIKey | DKQRBLRTIWDFHL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|