C20H22N6O — CID 143908002
N'-ethenyl-3-[3-(ethylamino)phenyl]-N-methylideneimidazo[1,2-a]pyridine-7-carboximidamide;formamide (PubChem CID 143908002) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is N'-ethenyl-3-[3-(ethylamino)phenyl]-N-methylideneimidazo[1,2-a]pyridine-7-carboximidamide;formamide.
| Compound Name | N'-ethenyl-3-[3-(ethylamino)phenyl]-N-methylideneimidazo[1,2-a]pyridine-7-carboximidamide;formamide |
|---|---|
| PubChem CID | 143908002 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N'-ethenyl-3-[3-(ethylamino)phenyl]-N-methylideneimidazo[1,2-a]pyridine-7-carboximidamide;formamide |
| SMILES | C=C/N=C(\N=C)c1ccn2c(-c3cccc(NCC)c3)cnc2c1.NC=O |
| InChI | InChI=1S/C19H19N5.CH3NO/c1-4-21-16-8-6-7-14(11-16)17-13-23-18-12-15(9-10-24(17)18)19(20-3)22-5-2;2-1-3/h5-13,21H,2-4H2,1H3;1H,(H2,2,3)/b22-19-; |
| InChIKey | ZWJKOEGGCKLVQA-GXTSIBQPSA-N |
| XLogP | 3.13 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|