C31H37N3O2 — CID 143789516
4-[(1R)-2-cyclopentyl-1-[4-(pyridin-2-ylmethoxy)phenyl]ethyl]-N-piperidin-4-ylbenzamide (PubChem CID 143789516) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 4-[(1R)-2-cyclopentyl-1-[4-(pyridin-2-ylmethoxy)phenyl]ethyl]-N-piperidin-4-ylbenzamide.
| Compound Name | 4-[(1R)-2-cyclopentyl-1-[4-(pyridin-2-ylmethoxy)phenyl]ethyl]-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 143789516 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 4-[(1R)-2-cyclopentyl-1-[4-(pyridin-2-ylmethoxy)phenyl]ethyl]-N-piperidin-4-ylbenzamide |
| SMILES | O=C(NC1CCNCC1)c1ccc([C@@H](CC2CCCC2)c2ccc(OCc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O2/c35-31(34-27-16-19-32-20-17-27)26-10-8-24(9-11-26)30(21-23-5-1-2-6-23)25-12-14-29(15-13-25)36-22-28-7-3-4-18-33-28/h3-4,7-15,18,23,27,30,32H,1-2,5-6,16-17,19-22H2,(H,34,35)/t30-/m1/s1 |
| InChIKey | FMVNAMVSLCXTGR-SSEXGKCCSA-N |
| XLogP | 5.85 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |