C12H16F6N2O2 — CID 143789989
2,2,2-trifluoroethyl (E,1E)-N-[(E)-1-(methylamino)prop-1-enyl]-3-(2,2,2-trifluoroethoxy)but-2-enimidate (PubChem CID 143789989) has the molecular formula C12H16F6N2O2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (E,1E)-N-[(E)-1-(methylamino)prop-1-enyl]-3-(2,2,2-trifluoroethoxy)but-2-enimidate.
| Compound Name | 2,2,2-trifluoroethyl (E,1E)-N-[(E)-1-(methylamino)prop-1-enyl]-3-(2,2,2-trifluoroethoxy)but-2-enimidate |
|---|---|
| PubChem CID | 143789989 |
| Molecular Formula | C12H16F6N2O2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2,2,2-trifluoroethyl (E,1E)-N-[(E)-1-(methylamino)prop-1-enyl]-3-(2,2,2-trifluoroethoxy)but-2-enimidate |
| SMILES | C/C=C(/N=C(\C=C(/C)OCC(F)(F)F)OCC(F)(F)F)NC |
| InChI | InChI=1S/C12H16F6N2O2/c1-4-9(19-3)20-10(22-7-12(16,17)18)5-8(2)21-6-11(13,14)15/h4-5,19H,6-7H2,1-3H3/b8-5+,9-4+,20-10+ |
| InChIKey | VUYDETCSWPHZID-ZVWJWIKXSA-N |
| XLogP | 3.53 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|