C27H32N2O5 — CID 143790450
3-O-benzyl 1-O-tert-butyl (3R)-2-oxopiperidine-1,3-dicarboxylate;7-methyl-1H-indole (PubChem CID 143790450) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 3-O-benzyl 1-O-tert-butyl (3R)-2-oxopiperidine-1,3-dicarboxylate;7-methyl-1H-indole.
| Compound Name | 3-O-benzyl 1-O-tert-butyl (3R)-2-oxopiperidine-1,3-dicarboxylate;7-methyl-1H-indole |
|---|---|
| PubChem CID | 143790450 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 3-O-benzyl 1-O-tert-butyl (3R)-2-oxopiperidine-1,3-dicarboxylate;7-methyl-1H-indole |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)OCc2ccccc2)C1=O.Cc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C18H23NO5.C9H9N/c1-18(2,3)24-17(22)19-11-7-10-14(15(19)20)16(21)23-12-13-8-5-4-6-9-13;1-7-3-2-4-8-5-6-10-9(7)8/h4-6,8-9,14H,7,10-12H2,1-3H3;2-6,10H,1H3/t14-;/m1./s1 |
| InChIKey | VDPDNYWQUARRTO-PFEQFJNWSA-N |
| XLogP | 5.38 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|