About methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate
methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate (PubChem CID 143790884) has the molecular formula C21H23NO9S
and a molecular weight of 465.48 g/mol. Its IUPAC name is methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate |
| PubChem CID | 143790884 |
| Molecular Formula | C21H23NO9S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OCOC(=O)c1ccc(SCCCON=O)cc1.CO |
| InChI | InChI=1S/C20H19NO8S.CH4O/c1-14(22)29-18-6-3-2-5-17(18)20(24)27-13-26-19(23)15-7-9-16(10-8-15)30-12-4-11-28-21-25;1-2/h2-3,5-10H,4,11-13H2,1H3;2H,1H3 |
| InChIKey | MCMZORTUCMNLEE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate?
The IUPAC name of methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate (CID 143790884) is methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate.
What is the SMILES notation for methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate?
The canonical SMILES for methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OCOC(=O)c1ccc(SCCCON=O)cc1.CO.
What is the InChIKey of methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate?
The InChIKey is MCMZORTUCMNLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO8S.CH4O/c1-14(22)29-18-6-3-2-5-17(18)20(24)27-13-26-19(23)15-7-9-16(10-8-15)30-12-4-11-28-21-25;1-2/h2-3,5-10H,4,11-13H2,1H3;2H,1H3.
What are the key properties of methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate?
methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate has a molecular weight of 465.48 g/mol, XLogP of 3.37, 11 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;[4-(3-nitrosooxypropylsulfanyl)benzoyl]oxymethyl 2-acetyloxybenzoate is sourced from PubChem (CID 143790884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).