C13H22N2 — CID 143790959
1-methyl-4-[(3Z)-4-methyl-2-methylidenehexa-3,5-dienyl]piperazine (PubChem CID 143790959) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-methyl-4-[(3Z)-4-methyl-2-methylidenehexa-3,5-dienyl]piperazine.
| Compound Name | 1-methyl-4-[(3Z)-4-methyl-2-methylidenehexa-3,5-dienyl]piperazine |
|---|---|
| PubChem CID | 143790959 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-methyl-4-[(3Z)-4-methyl-2-methylidenehexa-3,5-dienyl]piperazine |
| SMILES | C=C/C(C)=C\C(=C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C13H22N2/c1-5-12(2)10-13(3)11-15-8-6-14(4)7-9-15/h5,10H,1,3,6-9,11H2,2,4H3/b12-10- |
| InChIKey | ZGDNKXGAZHLOHS-BENRWUELSA-N |
| XLogP | 1.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|