C23H26ClN3O2 — CID 143791438
(6-chloropyrimidin-4-yl)-[1-[3-(oxocan-4-yl)propyl]indol-3-yl]methanone (PubChem CID 143791438) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is (6-chloropyrimidin-4-yl)-[1-[3-(oxocan-4-yl)propyl]indol-3-yl]methanone.
| Compound Name | (6-chloropyrimidin-4-yl)-[1-[3-(oxocan-4-yl)propyl]indol-3-yl]methanone |
|---|---|
| PubChem CID | 143791438 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (6-chloropyrimidin-4-yl)-[1-[3-(oxocan-4-yl)propyl]indol-3-yl]methanone |
| SMILES | O=C(c1cc(Cl)ncn1)c1cn(CCCC2CCCCOCC2)c2ccccc12 |
| InChI | InChI=1S/C23H26ClN3O2/c24-22-14-20(25-16-26-22)23(28)19-15-27(21-9-2-1-8-18(19)21)11-5-7-17-6-3-4-12-29-13-10-17/h1-2,8-9,14-17H,3-7,10-13H2 |
| InChIKey | BWQPMGXEEMKCMD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |