C18H30N2O2 — CID 143791717
ethane;(2E)-1-morpholin-4-yl-2-[(E)-2-piperidin-4-ylethenyl]penta-2,4-dien-1-one (PubChem CID 143791717) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethane;(2E)-1-morpholin-4-yl-2-[(E)-2-piperidin-4-ylethenyl]penta-2,4-dien-1-one.
| Compound Name | ethane;(2E)-1-morpholin-4-yl-2-[(E)-2-piperidin-4-ylethenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 143791717 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | ethane;(2E)-1-morpholin-4-yl-2-[(E)-2-piperidin-4-ylethenyl]penta-2,4-dien-1-one |
| SMILES | C=C/C=C(\C=C\C1CCNCC1)C(=O)N1CCOCC1.CC |
| InChI | InChI=1S/C16H24N2O2.C2H6/c1-2-3-15(5-4-14-6-8-17-9-7-14)16(19)18-10-12-20-13-11-18;1-2/h2-5,14,17H,1,6-13H2;1-2H3/b5-4+,15-3+; |
| InChIKey | ZSZQEBWECQWBJB-OGSYDDRGSA-N |
| XLogP | 2.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|