C48H30F3N5S — CID 143793772
2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[1-phenyl-2-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-6-yl]phenyl]phenyl]-1,3-benzothiazole (PubChem CID 143793772) has the molecular formula C48H30F3N5S and a molecular weight of 765.86 g/mol. Its IUPAC name is 2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[1-phenyl-2-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-6-yl]phenyl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[1-phenyl-2-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-6-yl]phenyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 143793772 |
| Molecular Formula | C48H30F3N5S |
| Molecular Weight | 765.86 g/mol |
| Exact Mass | 765.22 |
| IUPAC Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-[3-[1-phenyl-2-[4-(trifluoromethyl)phenyl]-4H-pyrimidin-6-yl]phenyl]phenyl]-1,3-benzothiazole |
| SMILES | FC(F)(F)c1ccc(C2=NCC=C(c3cccc(-c4cc(-c5nc6ccccc6s5)cc(-c5cc6cccnc6c6ncccc56)c4)c3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C48H30F3N5S/c49-48(50,51)37-19-17-30(18-20-37)46-54-24-21-42(56(46)38-12-2-1-3-13-38)32-10-6-9-31(25-32)34-26-35(28-36(27-34)47-55-41-15-4-5-16-43(41)57-47)40-29-33-11-7-22-52-44(33)45-39(40)14-8-23-53-45/h1-23,25-29H,24H2 |
| InChIKey | GFCXHNHOLZLLAP-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 54.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.86 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|