C9H17N3 — CID 143794541
2-[amino(methyl)amino]-4-ethylcyclohexa-1,3-dien-1-amine (PubChem CID 143794541) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-4-ethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 2-[amino(methyl)amino]-4-ethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143794541 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2-[amino(methyl)amino]-4-ethylcyclohexa-1,3-dien-1-amine |
| SMILES | CCC1=CC(N(C)N)=C(N)CC1 |
| InChI | InChI=1S/C9H17N3/c1-3-7-4-5-8(10)9(6-7)12(2)11/h6H,3-5,10-11H2,1-2H3 |
| InChIKey | OTZFPHGTRFPPKR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|